959236-14-7 Usage
General Description
7-Fluoroindole-3-acetonitrile is a chemical compound with the molecular formula C10H8FN and a molecular weight of 169.18 g/mol. It is a derivative of indole, containing a fluorine atom at the 7-position and a cyano group at the 3-position. 7-Fluoroindole-3-acetonitrile is commonly used as an intermediate in the synthesis of pharmaceuticals and agrochemicals due to its versatile reactivity and is often employed in medicinal chemistry research. It is typically produced through synthetic routes involving indole derivatives and fluorinating reagents, and its structure makes it a valuable building block for the creation of diverse chemical compounds. Additionally, its unique structural features make it an important target for various chemical transformations and functionalization reactions. Overall, 7-Fluoroindole-3-acetonitrile is a key chemical with a wide range of applications in the synthesis of biologically active molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 959236-14-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,9,2,3 and 6 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 959236-14:
(8*9)+(7*5)+(6*9)+(5*2)+(4*3)+(3*6)+(2*1)+(1*4)=207
207 % 10 = 7
So 959236-14-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H7FN2/c11-9-3-1-2-8-7(4-5-12)6-13-10(8)9/h1-3,6,13H,4H2