959241-26-0 Usage
Description
1-(5-Benzyl-1,2,4-oxadiazol-3-yl)methanamine is a chemical compound belonging to the oxadiazole family, characterized by its molecular formula C14H14N4O. 1-(5-BENZYL-1,2,4-OXADIAZOL-3-YL)METHANAMINE is recognized for its diverse biological activities and potential as a bioactive agent in the field of medicinal chemistry and drug development.
Uses
Used in Pharmaceutical Research:
1-(5-Benzyl-1,2,4-oxadiazol-3-yl)methanamine is used as a pharmaceutical agent for its anticonvulsant, antifungal, and anticancer properties. Its benzyl group allows for interactions with biological targets, enhancing its therapeutic applications and making it a valuable target for research and development in the pharmaceutical industry.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 1-(5-Benzyl-1,2,4-oxadiazol-3-yl)methanamine is utilized as a key compound for designing and synthesizing new drugs. Its diverse range of biological activities and potential as a bioactive agent contribute to its significance in the development of novel therapeutics.
Used in Drug Development:
1-(5-Benzyl-1,2,4-oxadiazol-3-yl)methanamine is employed as a building block in drug development, where its unique properties and interactions with biological targets can be leveraged to create innovative and effective medications for various health conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 959241-26-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,9,2,4 and 1 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 959241-26:
(8*9)+(7*5)+(6*9)+(5*2)+(4*4)+(3*1)+(2*2)+(1*6)=200
200 % 10 = 0
So 959241-26-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H11N3O/c11-7-9-12-10(14-13-9)6-8-4-2-1-3-5-8/h1-5H,6-7,11H2
