99184-85-7 Usage
General Description
(1,3-Benzothiazol-2-ylmethyl)thio]acetic acid is a chemical compound with a complex molecular structure. It belongs to the class of thio compounds, which are characterized by the presence of a sulfur atom in their structure. (1,3-BENZOTHIAZOL-2-YLMETHYL)THIO]ACETIC ACID has potential applications in various fields, including organic synthesis, pharmaceuticals, and material science. Its molecular structure contains a benzothiazole ring, which is a heterocyclic compound with potential biological activity. The presence of the thio group in the molecule gives it unique properties and potential for functionalization. Overall, (1,3-Benzothiazol-2-ylmethyl)thio]acetic acid is a versatile compound with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 99184-85-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,9,1,8 and 4 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 99184-85:
(7*9)+(6*9)+(5*1)+(4*8)+(3*4)+(2*8)+(1*5)=187
187 % 10 = 7
So 99184-85-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H9NO2S2/c12-10(13)6-14-5-9-11-7-3-1-2-4-8(7)15-9/h1-4H,5-6H2,(H,12,13)
99184-85-7Relevant articles and documents
Synthesis of some new oxazolinyl/thia-zolinyl/imidazolinyl-benzoxazoles, benzothiazoles and benzimidazoles
Seenaiah,Venkatesh,Padmaja,Padmavathi
, p. 942 - 948 (2013/08/15)
A new class of oxazolinyl/thiazolinyl/imidazolinyl-benzo- xazoles/benzothiazoles/benzimidazoles have been prepared by exploiting the respective heterocyclic sulfonyl acetic acid methyl ester functionality with different nucleophiles using samarium(III) chloride.
