(2R,3S,4R,5R)-2-(aminomethyl)oxane-2,3,4,5-tetrol

The Fructosamine, with the CAS registry number 4429-04-3, is also known as D-Isoglucosamine. This chemical's molecular formula is C₆H₁₃NO₅ and molecular weight is 179.1711. Its IUPAC name is called 1-Amino-1-deoxy-D-fructopyranose.

Physical properties of Fructosamine: (1)# of Rule of 5 Violations: 1; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1; (5)ACD/KOC (pH 7.4): 1; (6)#H bond acceptors: 6; (7)#H bond donors: 6; (8)#Freely Rotating Bonds: 6; (9)Index of Refraction: 1.64; (10)Molar Refractivity: 39.16 cm³; (11)Molar Volume: 108.6 cm³; (12)Surface Tension: 84.6 dyne/cm; (13)Density: 1.649 g/cm³; (14)Flash Point: 181.6 °C; (15)Enthalpy of Vaporization: 72.23 kJ/mol; (16)Boiling Point: 376.7 °C at 760 mmHg; (17)Vapour Pressure: 3.22E-07 mmHg at 25°C.

Preparation: Fructosamine is a compound that can be considered the result of a reaction between fructose and ammonia or an amine (with a molecule of water being released). A fructosamine is also formed when carbonyl group of glucose reacts with an amino group of a protein, as the double bond to oxygen moves from the end carbon atom to the next carbon atom and water is released.

Uses of Fructosamine: it can be used to identify the plasma glucose concentration over time and so assess diabetic control over an intermediate period of time. Fructosamine is also of use in conditions, such as pregnancy, in which hormonal changes cause greater short-term fluctuation in glucose concentrations.

You can still convert the following datas into molecular structure:
(1)SMILES: O[C@H]1[C@H](O)[C@H](O)COC1(O)CN
(2)InChI: InChI=1/C6H13NO5/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5,8-11H,1-2,7H2/t3-,4-,5+,6?/m1/s1
(3)InChIKey: IXZISFNWUWKBOM-VRPWFDPXBE