The Propanoic acid, 2-(2,4-dichlorophenoxy)-, magnesium salt (2:1) has the CAS registry number 29413-61-4. Its EINECS number is 249-610-0. This chemical's molecular formula is C18H14Cl4MgO6 and molecular weight is 492.42. What's more, its systematic name is magnesium bis[2-(2,4-dichlorophenoxy)propanoate].
Physical properties of Propanoic acid, 2-(2,4-dichlorophenoxy)-, magnesium salt (2:1) are: (1)#H bond acceptors: 6; (2)#H bond donors: 2; (3)#Freely Rotating Bonds: 6; (4)Polar Surface Area: 98.72 Å2.
You can still convert the following datas into molecular structure:
(1)SMILES: [Mg+2].Clc1cc(Cl)ccc1OC(C)C([O-])=O.[O-]C(=O)C(C)Oc1ccc(Cl)cc1Cl
(2)InChI: InChI=1S/2C9H8Cl2O3.Mg/c2*1-5(9(12)13)14-8-3-2-6(10)4-7(8)11;/h2*2-5H,1H3,(H,12,13);/q;;+2/p-2
(3)InChIKey: PVAAOBAQAZXOQT-UHFFFAOYSA-L
About|Contact|Cas|Product Name|Molecular|Country|Encyclopedia
Message|New Cas|MSDS|Service|Advertisement|CAS DataBase|Article Data|Manufacturers | Chemical Catalog
©2008 LookChem.com,License: ICP
NO.:Zhejiang16009103
complaints:service@lookchem.com Desktop View