10-13-9 Usage
General Description
4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-2-methoxy-benzene-1,3-diol is a compound with a complex chemical structure. It contains a benzene ring with two methoxy groups and two hydroxy groups positioned at the 1, 3, and 2 positions, respectively. Additionally, it features an ethenyl group attached to the 2 position of the benzene ring, giving it a specific geometric isomerism denoted by the (E)- prefix. 4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-2-methoxy-benzene-1,3-diol is commonly found in natural substances such as plants or fruits and may have potential applications in pharmaceuticals or as a chemical intermediate in organic synthesis. Its structural complexity and the presence of multiple functional groups make it an interesting subject for further study and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 10-13-9 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 1 and 0 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 10-13:
(4*1)+(3*0)+(2*1)+(1*3)=9
9 % 10 = 9
So 10-13-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H14O5/c1-20-15-13(18)5-4-10(14(15)19)3-2-9-6-11(16)8-12(17)7-9/h2-8,16-19H,1H3/b3-2+
