100063-61-4 Usage
General Description
2-[[[2-[[2-[[2-[[(2-hydroxyethyl)amino]carbonyl]benzoyl]amino]ethyl](hydroxymethyl)amino]ethyl]amino]carbonyl]benzoic acid is a complex chemical compound with a long and specific structure. It contains multiple amino and carbonyl groups, as well as benzoyl and hydroxyethyl moieties. The compound is a derivative of benzoic acid and has potential applications in pharmaceuticals and biological research due to its complex and specific structure. Its properties and potential uses would need to be further studied and evaluated in order to fully understand its potential impact and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 100063-61-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,0,6 and 3 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 100063-61:
(8*1)+(7*0)+(6*0)+(5*0)+(4*6)+(3*3)+(2*6)+(1*1)=54
54 % 10 = 4
So 100063-61-4 is a valid CAS Registry Number.
InChI:InChI=1/C23H28N4O7/c28-14-11-26-21(31)17-6-2-1-5-16(17)20(30)24-9-12-27(15-29)13-10-25-22(32)18-7-3-4-8-19(18)23(33)34/h1-8,28-29H,9-15H2,(H,24,30)(H,25,32)(H,26,31)(H,33,34)