100836-88-2 Usage
Description
Methyl 2-Acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-b-D-glucopyranoside, with the CAS number 100836-88-2, is a white powder compound that is useful in organic synthesis. It is a derivative of a disaccharide, consisting of a b-D-glucopyranoside unit linked to a b-D-galactopyranosyl unit through a glycosidic bond. The presence of an acetamido group at the second position of the glucopyranoside unit adds to its unique chemical properties.
Uses
1. Used in Organic Synthesis:
Methyl 2-Acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-b-D-glucopyranoside is used as a synthetic intermediate for the preparation of various complex organic compounds, particularly those involving glycosidic linkages. Its unique structure allows for the development of novel molecules with potential applications in various fields.
2. Used in Pharmaceutical Industry:
In the pharmaceutical industry, Methyl 2-Acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-b-D-glucopyranoside is used as a building block for the synthesis of glycoconjugates, which are essential components of many biologically active molecules, such as antibiotics, antivirals, and vaccines. The compound's ability to form glycosidic bonds with other molecules makes it a valuable tool in the development of new drugs with improved efficacy and reduced side effects.
3. Used in Chemical Research:
Methyl 2-Acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-b-D-glucopyranoside is also used in chemical research to study the properties and reactivity of glycosidic bonds. Understanding the behavior of these bonds is crucial for the development of new synthetic methods and the design of novel bioactive compounds.
4. Used in Material Science:
In material science, Methyl 2-Acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-b-D-glucopyranoside can be used to develop new materials with unique properties, such as improved biocompatibility or enhanced mechanical strength. The compound's ability to form hydrogen bonds and interact with other molecules makes it a promising candidate for the development of advanced materials with specific applications.
5. Used in Food Industry:
In the food industry, Methyl 2-Acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-b-D-glucopyranoside can be used as a component in the development of new food additives or ingredients with improved taste, texture, or nutritional properties. Its ability to form glycosidic bonds with other molecules can be exploited to create novel flavor compounds or to improve the stability of existing additives.
Check Digit Verification of cas no
The CAS Registry Mumber 100836-88-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,8,3 and 6 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 100836-88:
(8*1)+(7*0)+(6*0)+(5*8)+(4*3)+(3*6)+(2*8)+(1*8)=102
102 % 10 = 2
So 100836-88-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H27NO11/c1-5(19)16-8-13(10(21)7(4-18)25-14(8)24-2)27-15-12(23)11(22)9(20)6(3-17)26-15/h6-15,17-18,20-23H,3-4H2,1-2H3,(H,16,19)
100836-88-2Relevant articles and documents
Stereoselective preparation of alkyl glycosides of 2-acetamido-2-deoxy-α-D-glucopyranose by nonclassical halide-ion catalysis and synthesis and NMR spectroscopy of α-D-Gal p-(1-->3)-α-D-Glc pNAc-OMe
Pozsgay, Vince,Coxon, Bruce
, p. 171 - 178 (2007/10/02)
Keywords: Alkyl glycosides; 2-Acetamido-2-deoxy-α-D-glucopyranose; α-D-Gal p-(1 --> 3)-α-d-GlcpNAcOMe
Synthesis of methyl O-α-L-fucopyranosyl- (1 → 2)- O-β-D-galactopyranosyl- (1 → 3)- 2-acetamido- 2-deoxy-β-D-glucopyranoside, using 2,3,4-tri-O-benzoyl-α-L-fucopyranosyl bromide as the α-L-fucosylating agent
Nifant'ev,Shashkov,Kochetkov
, p. 331 - 336 (2007/10/02)
The authors cover the synthesis of trisaccharide methyl glycosides using fucosylation. Fucopyranosyl bromide was used as the fucosylating agent. The melting point, optical rotations, and NMR spectra of these glycosides are reported.