100960-08-5 Usage
Description
3-Amino-7-azaindole hydrochloride, also known as 3-Amino-7-azaindole dihydrochloride (DiHCl), is an organic compound with the molecular formula C8H7N5·2HCl. It is a derivative of the indole family, featuring a nitrogen atom at the 7th position, which distinguishes it from traditional indole compounds. This unique structure endows 3-Amino-7-azaindole hydrochloride with specific chemical and biological properties, making it a versatile compound for various applications.
Uses
Used in Pharmaceutical and Chemical Synthesis:
3-Amino-7-azaindole hydrochloride is used as a reagent for the preparation of 5and 6-substituted 7-azaindoles. These substituted 7-azaindoles are important intermediates in the synthesis of various pharmaceutical compounds, including potential therapeutic agents and drug candidates. The unique structural features of 3-Amino-7-azaindole hydrochloride allow for the efficient and selective synthesis of these valuable compounds, contributing to the development of novel drugs and therapies.
In addition to its use in pharmaceutical and chemical synthesis, 3-Amino-7-azaindole hydrochloride may also find applications in other industries, such as materials science, where its unique properties could be harnessed for the development of new materials with specific characteristics. However, further research and development would be required to explore these potential applications fully.
Check Digit Verification of cas no
The CAS Registry Mumber 100960-08-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,9,6 and 0 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 100960-08:
(8*1)+(7*0)+(6*0)+(5*9)+(4*6)+(3*0)+(2*0)+(1*8)=85
85 % 10 = 5
So 100960-08-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N3.ClH/c8-6-4-10-7-5(6)2-1-3-9-7;/h1-4H,8H2,(H,9,10);1H
