10137-65-2 Usage
Description
6-Cyanohexanoic acid ethyl ester, also known as ethyl 6-cyanohexanoate, is a chemical compound with the molecular formula C9H15NO2. It is characterized by its cyanide functional group, which allows for versatile use in organic chemistry reactions. This ester is known for its slightly fruity odor and is commonly utilized as a flavoring agent in the food and beverage industry. Additionally, it has potential applications in the development of new materials and as a reagent in research and development laboratories.
Uses
Used in Pharmaceutical Industry:
6-Cyanohexanoic acid ethyl ester is used as an intermediate in the synthesis and production of various pharmaceuticals. Its cyanide functional group allows for versatile use in organic chemistry reactions, making it a valuable component in the development of new drugs.
Used in Agrochemical Industry:
6-Cyanohexanoic acid ethyl ester is used in the synthesis and production of various agrochemicals. Its versatility in organic chemistry reactions makes it a valuable component in the development of new pesticides and other agricultural chemicals.
Used in Flavoring Agent:
6-Cyanohexanoic acid ethyl ester is used as a flavoring agent in the food and beverage industry. Its slightly fruity odor makes it a desirable component in creating unique and appealing flavors for various products.
Used in Material Development:
6-Cyanohexanoic acid ethyl ester has potential applications in the development of new materials. Its cyanide functional group allows for versatile use in organic chemistry reactions, making it a valuable component in the creation of innovative materials.
Used in Research and Development Laboratories:
6-Cyanohexanoic acid ethyl ester is used as a reagent in research and development laboratories. Its versatility in organic chemistry reactions makes it a valuable tool for scientists and researchers in the development of new compounds and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 10137-65-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,1,3 and 7 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 10137-65:
(7*1)+(6*0)+(5*1)+(4*3)+(3*7)+(2*6)+(1*5)=62
62 % 10 = 2
So 10137-65-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H15NO2/c1-2-12-9(11)7-5-3-4-6-8-10/h2-7H2,1H3
10137-65-2Relevant articles and documents
Photoredox/Nickel Dual Catalysis for the C(sp3)–C(sp3) Cross-Coupling of Alkylsilicates with Alkyl Halides
Lévêque, Christophe,Corcé, Vincent,Chenneberg, Ludwig,Ollivier, Cyril,Fensterbank, Louis
supporting information, p. 2118 - 2121 (2017/04/24)
Alkylsilicates were engaged under photoredox/nickel dual catalysis conditions with alkyl halides for the first time. The C(sp3)–C(sp3) cross-coupling products were obtained in moderate yields and were accompanied by the homocoupling
