10140-08-6 Usage
General Description
1-[2-[2-[Bis(2,6-diethylphenyl)methoxy]ethoxy]ethyl]-4-methylpiperazine is a complex chemical compound that consists of multiple functional groups. It contains a piperazine ring, a methyl group, and multiple ether linkages. The bis(2,6-diethylphenyl)methoxy group is a bulky substituent that is attached to the piperazine ring, and there are two ethoxyethyl groups connected to it, giving the molecule a long and flexible structure. 1-[2-[2-[Bis(2,6-diethylphenyl)methoxy]ethoxy]ethyl]-4-methylpiperazine is likely to have pharmacological properties, as piperazine derivatives are commonly used in pharmaceuticals. Its specific properties and potential uses would depend on its interactions with biological systems, and further research would be needed to fully understand its effects.
Check Digit Verification of cas no
The CAS Registry Mumber 10140-08-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,1,4 and 0 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 10140-08:
(7*1)+(6*0)+(5*1)+(4*4)+(3*0)+(2*0)+(1*8)=36
36 % 10 = 6
So 10140-08-6 is a valid CAS Registry Number.
InChI:InChI=1/C30H46N2O2/c1-6-24-12-10-13-25(7-2)28(24)30(29-26(8-3)14-11-15-27(29)9-4)34-23-22-33-21-20-32-18-16-31(5)17-19-32/h10-15,30H,6-9,16-23H2,1-5H3