10162-32-0 Usage
Core structure
Pteridin-4-one
Components
Amino group: Confers basic properties and potential for interaction with acidic molecules.
Tetrahydropteridin ring: Forms the central ring structure of the compound.
1,2,3-trihydroxypropyl side chain: Attached to the pteridin-4-one core, offering potential for interaction with biological molecules.
Pharmaceutical potential
Due to its interaction capabilities with biological systems, it holds promise for pharmaceutical applications.
Potential interactions
With proteins or enzymes due to the presence of both the amino group and the hydroxypropyl side chain.
Importance for drug development
Its ability to interact with biological molecules makes it a candidate for further study and potential drug development endeavors.
Check Digit Verification of cas no
The CAS Registry Mumber 10162-32-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,1,6 and 2 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 10162-32:
(7*1)+(6*0)+(5*1)+(4*6)+(3*2)+(2*3)+(1*2)=50
50 % 10 = 0
So 10162-32-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H11N5O4/c10-9-13-7-5(8(18)14-9)12-3(1-11-7)6(17)4(16)2-15/h1,4,6,15-17H,2H2,(H3,10,11,13,14,18)/t4-,6-/m1/s1
