10200-27-8 Usage
General Description
4-methylpimelic acid is a chemical compound with the molecular formula C8H14O4. It is a carboxylic acid with a methyl group attached to the carbon chain, and it is classified as an aliphatic compound. 4-methylpimelic acid is often used in the synthesis of various pharmaceuticals and other organic compounds due to its ability to act as a precursor in chemical reactions. Its structure and properties make it suitable for a range of applications in the chemical and pharmaceutical industries. As a carboxylic acid, 4-methylpimelic acid is also known for its acidity and ability to readily donate protons in chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 10200-27-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,0 and 0 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 10200-27:
(7*1)+(6*0)+(5*2)+(4*0)+(3*0)+(2*2)+(1*7)=28
28 % 10 = 8
So 10200-27-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H14O4/c1-6(2-4-7(9)10)3-5-8(11)12/h6H,2-5H2,1H3,(H,9,10)(H,11,12)
