102073-77-8 Usage
General Description
5,8-DIMETHOXY-1,2,3,4-TETRAHYDROISOQUINOLIN-4-OL HYDROCHLORIDE is a chemical compound with the molecular formula C11H16ClNO3. It is an alkaloid derivative and is commonly used as a pharmaceutical intermediate in the synthesis of various drugs. 5,8-DIMETHOXY-1,2,3,4-TETRAHYDROISOQUINOLIN-4-OL HYDROCHLORIDE has been studied for its potential pharmacological properties, including its potential as an analgesic, anti-inflammatory, and neuroprotective agent. Its unique chemical structure and pharmacological properties make it a valuable compound in the field of medicinal chemistry and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 102073-77-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,2,0,7 and 3 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 102073-77:
(8*1)+(7*0)+(6*2)+(5*0)+(4*7)+(3*3)+(2*7)+(1*7)=78
78 % 10 = 8
So 102073-77-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NO3/c1-14-9-3-4-10(15-2)11-7(9)5-12-6-8(11)13/h3-4,8,12-13H,5-6H2,1-2H3
