10293-59-1 Usage
Description
2-acetamidoglucal, also known as a glycal derivative, is a compound characterized by its unique structure of 1,5-anhydro-2-deoxy-D-arabino-hex-1-enitol with an acetylamino group substitution at position 2. This chemical structure grants it potential applications in various fields due to its functional groups and reactivity.
Uses
Used in Pharmaceutical Industry:
2-acetamidoglucal is used as a building block for the synthesis of various pharmaceutical compounds, particularly those with potential therapeutic applications. Its unique structure allows for the creation of novel molecules with specific biological activities, making it a valuable asset in drug discovery and development.
Used in Chemical Synthesis:
In the field of organic chemistry, 2-acetamidoglucal is used as an intermediate for the synthesis of complex organic molecules. Its acetylamino group at position 2 provides a versatile functional group that can be further modified or used in the formation of various chemical bonds, facilitating the creation of a wide range of compounds with different properties and applications.
Used in Research and Development:
2-acetamidoglucal serves as a valuable research tool in the study of carbohydrate chemistry and glycobiology. Its unique structure allows scientists to explore the interactions between carbohydrates and other biomolecules, such as proteins and lipids, which can lead to a better understanding of various biological processes and the development of new therapeutic strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 10293-59-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,9 and 3 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 10293-59:
(7*1)+(6*0)+(5*2)+(4*9)+(3*3)+(2*5)+(1*9)=81
81 % 10 = 1
So 10293-59-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H13NO5/c1-4(11)9-5-3-14-6(2-10)8(13)7(5)12/h3,6-8,10,12-13H,2H2,1H3,(H,9,11)
