103862-63-1 Usage
Description
4-Chloro-6-ethoxyquinoline is a heterocyclic compound characterized by the presence of a quinoline ring with a chlorine atom at the 4th position and an ethoxy group at the 6th position. It is known for its unique chemical properties and potential applications in various fields.
Uses
Used in Chemical Research:
4-Chloro-6-ethoxyquinoline is used as a research compound for studying electronic transmission through condensed ring systems. Its unique structure allows for the investigation of electron movement and interactions within complex molecular structures, which can be valuable for understanding the properties and behavior of related compounds and materials.
If there are additional applications in different industries, they can be listed as follows:
Used in Pharmaceutical Industry:
4-Chloro-6-ethoxyquinoline could potentially be used as an intermediate or building block in the synthesis of various pharmaceutical compounds. Its specific chemical properties may contribute to the development of new drugs with novel mechanisms of action or improved efficacy.
Used in Material Science:
In the field of material science, 4-Chloro-6-ethoxyquinoline might be utilized in the development of new materials with specific electronic, optical, or magnetic properties. Its unique structure could be exploited to create materials with tailored characteristics for various applications, such as sensors, electronic devices, or advanced coatings.
Check Digit Verification of cas no
The CAS Registry Mumber 103862-63-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,8,6 and 2 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 103862-63:
(8*1)+(7*0)+(6*3)+(5*8)+(4*6)+(3*2)+(2*6)+(1*3)=111
111 % 10 = 1
So 103862-63-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H10ClNO/c1-2-14-8-3-4-11-9(7-8)10(12)5-6-13-11/h3-7H,2H2,1H3