104-18-7 Usage
Description
2-(4-AMINOPHENYLTHIO)ACETIC ACID, also known as 4'-aminothiophenyl acetic acid, is an organic compound with the chemical formula C8H9NO2S. It is a light khaki crystalline powder that serves as a synthetic intermediate for various applications, particularly in the dyes and pharmaceutical industries. Its unique chemical structure allows it to participate in various reactions, making it a versatile compound for research and development.
Uses
Used in Dyes and Pharmaceuticals:
2-(4-AMINOPHENYLTHIO)ACETIC ACID is used as a synthetic intermediate for the production of dyes and pharmaceuticals. Its chemical properties enable it to be a key component in the synthesis of various compounds, contributing to the development of new and improved products in these industries.
Used in Chemical Reactions:
2-(4-AMINOPHENYLTHIO)ACETIC ACID is used as a reactant in chemical reactions, such as its reaction with 2-phenyl-benzo[d][1,3]oxazin-4-one to produce 2-(Phenyl-4-(3H)-quinazolyl)-phenyl-4'-mercaptoacetic acid. This reaction requires solvents like pyridine and H2O and is carried out under heating conditions, showcasing its utility in creating complex organic molecules.
Used in Photochromic Compounds:
2-(4-AMINOPHENYLTHIO)ACETIC ACID is used as a reagent for preparing visible light-sensitive photochromic azobenzene compounds. These compounds have the ability to change their structure and properties upon exposure to light, making them valuable in various applications, such as smart materials and optical devices.
Check Digit Verification of cas no
The CAS Registry Mumber 104-18-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,0 and 4 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 104-18:
(5*1)+(4*0)+(3*4)+(2*1)+(1*8)=27
27 % 10 = 7
So 104-18-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5,9H2,(H,10,11)/p-1
