104077-15-8 Usage
Description
3-CHLOROCARBONYL-6,7-DIMETHOXY-1-METHYL-2(1H)-QUINOXALINONE is a complex organic compound characterized by its quinoxaline core structure, featuring a chlorocarbonyl group at the 3-position, a methyl group at the 1-position, and two methoxy groups at the 6 and 7 positions. This molecule is known for its reactivity and potential applications in various fields due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
3-CHLOROCARBONYL-6,7-DIMETHOXY-1-METHYL-2(1H)-QUINOXALINONE is used as a building block for the synthesis of various pharmaceutical compounds. Its unique structure and reactivity make it a valuable intermediate in the development of new drugs targeting a range of diseases.
Used in Chemical Research:
In the field of chemical research, 3-CHLOROCARBONYL-6,7-DIMETHOXY-1-METHYL-2(1H)-QUINOXALINONE serves as a key compound for studying the properties and reactions of quinoxaline derivatives. Its reactivity with various reagents allows researchers to explore new synthetic pathways and develop novel molecules with potential applications in various industries.
Used in Reactive Oxygen/Nitrogen Species (RONS) Research:
3-CHLOROCARBONYL-6,7-DIMETHOXY-1-METHYL-2(1H)-QUINOXALINONE is used as a model compound to study the role of reactive oxygen and nitrogen species in nitrosative stress and their contribution to the development of various diseases. Understanding the interactions of this molecule with RONS can provide insights into the underlying mechanisms of these diseases and aid in the development of targeted therapies.
Used in Material Science:
The unique properties of 3-CHLOROCARBONYL-6,7-DIMETHOXY-1-METHYL-2(1H)-QUINOXALINONE make it a potential candidate for the development of new materials with specific characteristics, such as improved stability, reactivity, or selectivity. Its application in material science can lead to the creation of advanced materials for various industrial applications, including electronics, coatings, and sensors.
Check Digit Verification of cas no
The CAS Registry Mumber 104077-15-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,4,0,7 and 7 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 104077-15:
(8*1)+(7*0)+(6*4)+(5*0)+(4*7)+(3*7)+(2*1)+(1*5)=88
88 % 10 = 8
So 104077-15-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H11ClN2O4/c1-15-7-5-9(19-3)8(18-2)4-6(7)14-10(11(13)16)12(15)17/h4-5H,1-3H3
104077-15-8Relevant articles and documents
Preparation of 3-Substituted 6,7-Dimethoxyquinoxalin-2(1H)-ones and Studies of Their Potential as Fluoroionophores
Ahmad, Abid R.,Mehta, Lina K.,Parrick, John
, p. 12899 - 12910 (2007/10/02)
Improved routes to the quinoxalinone acid chloride 1 and the 3-methyl-quinoxalinone 21 are described.These intermediates are used to obtain the fluoroionophores 15-19 and 27-29, respectively.The effects of the complexation of metal ions by the fluoroionophores is discussed.A red pigment 26 is obtained from 21.
