104183-46-2 Usage
Description
(5Z)-5-benzylidene-3-[[[4-(piperidine-1-carbonyl)phenyl]amino]methyl]2-sulfanylidene-thiazolidin-4-one is a complex organic compound that belongs to the class of thiazolidin-4-one derivatives. It contains a benzylidene group, a piperidine-1-carbonyl, and a phenylamino methyl group, all of which contribute to its chemical structure and properties. Thiazolidin-4-one derivatives have been studied for their potential biological activities, including antimicrobial, antiviral, anticancer, and anti-inflammatory properties. This specific compound may have potential applications in drug discovery and development due to its unique structure and potential pharmacological activities. Detailed studies and research are needed to fully understand the properties and potential uses of this compound.
Uses
Used in Pharmaceutical Industry:
(5Z)-5-benzylidene-3-[[[4-(piperidine-1-carbonyl)phenyl]amino]methyl]2-sulfanylidene-thiazolidin-4-one is used as a potential drug candidate for its potential antimicrobial, antiviral, anticancer, and anti-inflammatory properties. Its unique structure and potential pharmacological activities make it a promising compound for drug discovery and development.
Used in Drug Discovery and Development:
(5Z)-5-benzylidene-3-[[[4-(piperidine-1-carbonyl)phenyl]amino]methyl]2-sulfanylidene-thiazolidin-4-one is used as a starting point for the development of new drugs targeting various diseases and conditions. Its unique chemical structure and potential biological activities make it a valuable compound for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 104183-46-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,4,1,8 and 3 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 104183-46:
(8*1)+(7*0)+(6*4)+(5*1)+(4*8)+(3*3)+(2*4)+(1*6)=92
92 % 10 = 2
So 104183-46-2 is a valid CAS Registry Number.
InChI:InChI=1/C23H23N3O2S2/c27-21(25-13-5-2-6-14-25)18-9-11-19(12-10-18)24-16-26-22(28)20(30-23(26)29)15-17-7-3-1-4-8-17/h1,3-4,7-12,15,24H,2,5-6,13-14,16H2/b20-15-
104183-46-2Relevant articles and documents
Synthesis and Biodynamic Activities of 5-(Substituted benzylidene)-3--4-oxothiazolidine-2-thiones
Husain, M. I.,Shukla, Sarveshwar
, p. 761 - 764 (2007/10/02)
Twenty three title compounds (Va-w) have been synthesised by the Mannich Reaction between 5-arylidene-4-oxothiazolidine-2-thiones (II) and p-(N,N-disubstituted carbamoyl)anilines (IV) and screened for their antibacterial activity against B. cereus, S. aureus, M. flavus, S. lutae and B. subtilis, antiviral activity against Tobacco Mosaic Virus and CNS activities on albino mice.Some of the compounds give interesting results.Structure activity relationship has also been studied.