10457-59-7 Usage
Description
14-Isopropyldibenz[a,j]acridine is a polycyclic aromatic hydrocarbon compound that belongs to the dibenzacridine family. It is composed of two benzene rings fused with a central acridine ring and is known for its antitumor and antibacterial properties. However, it is also recognized as a mutagen and carcinogen, which poses potential health risks to humans upon exposure.
Uses
Used in Pharmaceutical Industry:
14-Isopropyldibenz[a,j]acridine is used as a chemical intermediate in the synthesis of various organic compounds, particularly those with potential pharmaceutical applications. Its antitumor and antibacterial properties make it a candidate for the development of new drugs targeting cancer and bacterial infections.
Used in Chemical Research:
In the field of chemical research, 14-Isopropyldibenz[a,j]acridine serves as a valuable compound for studying the structure and properties of polycyclic aromatic hydrocarbons. Its unique structure allows researchers to explore its potential applications and understand its biological activities.
Safety Precautions:
Due to the mutagen and carcinogen properties of 14-Isopropyldibenz[a,j]acridine, it is crucial to follow proper safety measures and use protective equipment when handling this chemical. This includes wearing gloves, lab coats, and safety goggles, as well as working in a well-ventilated area to minimize exposure risks.
Check Digit Verification of cas no
The CAS Registry Mumber 10457-59-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,4,5 and 7 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 10457-59:
(7*1)+(6*0)+(5*4)+(4*5)+(3*7)+(2*5)+(1*9)=87
87 % 10 = 7
So 10457-59-7 is a valid CAS Registry Number.
InChI:InChI=1/C24H19N/c1-15(2)22-23-18-9-5-3-7-16(18)11-13-20(23)25-21-14-12-17-8-4-6-10-19(17)24(21)22/h3-15H,1-2H3