10486-14-3 Usage
Description
RHODINYL PHENYLACETATE is a chemical compound known for its distinct rose absolute odor with a honey-like undertone. It possesses a very sweet, rose-honey taste and is characterized by its waxy and floral taste profile with powdery nuances at a concentration of 30 ppm.
Uses
Used in Flavor and Fragrance Industry:
RHODINYL PHENYLACETATE is used as a flavoring agent for its very sweet, rose-honey taste, adding a unique and pleasant flavor to various food and beverage products.
RHODINYL PHENYLACETATE is also used as a fragrance ingredient for its rose absolute odor with a honey-like undertone, contributing to the creation of various perfumes, cosmetics, and personal care products.
Used in Research and Development:
RHODINYL PHENYLACETATE can be utilized in the research and development of new compounds and materials, taking advantage of its unique chemical properties and interactions with other substances. This can lead to the discovery of novel applications and advancements in various fields.
Preparation
By esterification of rhodinol with phenylacetic acid.
Check Digit Verification of cas no
The CAS Registry Mumber 10486-14-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,4,8 and 6 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 10486-14:
(7*1)+(6*0)+(5*4)+(4*8)+(3*6)+(2*1)+(1*4)=83
83 % 10 = 3
So 10486-14-3 is a valid CAS Registry Number.
InChI:InChI=1/C18H26O2/c1-15(2)8-7-9-16(3)12-13-20-18(19)14-17-10-5-4-6-11-17/h4-6,10-11,16H,1,7-9,12-14H2,2-3H3
