104987-36-2 Usage
Description
Oenothein B is a macrocyclic ellagitannin, a type of polyphenolic compound, that can be derived from specific plant species such as Oenothera erythrosepala Bordas. It is known for its antitumor properties and its ability to inhibit certain enzymes, making it a potential candidate for pharmaceutical and therapeutic applications.
Uses
Used in Pharmaceutical Applications:
Oenothein B is used as an antitumor agent for its activity against MM2 ascites tumor. It demonstrates potential in the treatment of cancer due to its ability to inhibit tumor growth and progression.
Used in Enzyme Inhibition:
Oenothein B is used as an inhibitor for 5 alpha-reductase and aromatase enzymes. This application can be relevant in the treatment of conditions related to hormonal imbalances or enzyme overactivity, such as certain types of cancer or androgenetic disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 104987-36-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,4,9,8 and 7 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 104987-36:
(8*1)+(7*0)+(6*4)+(5*9)+(4*8)+(3*7)+(2*3)+(1*6)=142
142 % 10 = 2
So 104987-36-2 is a valid CAS Registry Number.
InChI:InChI=1/C68H50O44/c69-22-1-14(2-23(70)39(22)79)59(93)109-56-52(92)68(112-61(95)16-5-26(73)41(81)27(74)6-16)106-34-13-103-63(97)20-11-32(46(86)50(90)38(20)37-19(64(98)107-54(34)56)9-30(77)44(84)49(37)89)104-53-21(10-31(78)45(85)51(53)91)66(100)111-58-57(110-60(94)15-3-24(71)40(80)25(72)4-15)55-33(105-67(58)101)12-102-62(96)17-7-28(75)42(82)47(87)35(17)36-18(65(99)108-55)8-29(76)43(83)48(36)88/h1-11,33-34,52,54-58,67-92,101H,12-13H2/t33-,34-,52-,54+,55-,56+,57+,58-,67-,68+/m1/s1