1055-75-0 Usage
Description
Venenatine is an Alstonia alkaloid found in the bark of A. venenata R. Br. It is characterized by the presence of a methoxyl group, a non-phenolic hydroxyl group, and a methoxycarbonyl group. The compound has a specific rotation of [α]24D 76.07°. Various derivatives of venenatine, such as its hydriodide, picrate, methiodide, and O-acetate, have been synthesized and studied for their melting points and properties.
Uses
1. Used in Pharmaceutical Industry:
Venenatine is used as a pharmaceutical compound for its potential therapeutic applications. The presence of various functional groups in its structure allows for further chemical modifications and the development of new drugs with improved properties.
2. Used in Chemical Research:
Venenatine serves as a valuable compound for chemical research, particularly in the field of alkaloid chemistry. Its unique structure and functional groups make it an interesting subject for studying the synthesis, reactivity, and potential applications of related compounds.
3. Used in Drug Development:
The structural features of venenatine, such as the methoxyl, non-phenolic hydroxyl, and methoxycarbonyl groups, make it a promising candidate for drug development. Researchers can explore its potential as a lead compound in the development of new therapeutic agents targeting various diseases and conditions.
4. Used in Natural Product Chemistry:
As a naturally occurring alkaloid, venenatine contributes to the study of natural products and their potential applications in medicine and pharmacology. Understanding the properties and bioactivity of compounds like venenatine can lead to the discovery of novel therapeutic agents derived from nature.
References
Govindachari et al., Tetrahedron Lett., 901 (1964)
Check Digit Verification of cas no
The CAS Registry Mumber 1055-75-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,5 and 5 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1055-75:
(6*1)+(5*0)+(4*5)+(3*5)+(2*7)+(1*5)=60
60 % 10 = 0
So 1055-75-0 is a valid CAS Registry Number.
InChI:InChI=1/C22H28N2O4/c1-27-18-5-3-4-15-19(18)13-8-9-24-11-12-6-7-17(25)20(22(26)28-2)14(12)10-16(24)21(13)23-15/h3-5,12,14,16-17,20,23,25H,6-11H2,1-2H3