10581-62-1 Usage
General Description
2-(Chloromethyl)-1,3,5-triazine-4,6-diamine is a chemical compound with the molecular formula C5H7ClN4. It is commonly used as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. 2-(Chloromethyl)-1,3,5-triazine-4,6-diamine is a derivative of 1,3,5-triazine and contains a chloromethyl group, making it useful in the production of triazine-based herbicides and other biologically active compounds. It is also known for its reactivity and ability to undergo various chemical reactions, making it a versatile building block in organic synthesis. Additionally, its presence in certain antineoplastic agents highlights its potential as a key element in the development of new and effective cancer treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 10581-62-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,5,8 and 1 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 10581-62:
(7*1)+(6*0)+(5*5)+(4*8)+(3*1)+(2*6)+(1*2)=81
81 % 10 = 1
So 10581-62-1 is a valid CAS Registry Number.
InChI:InChI=1/C4H6ClN5/c5-1-2-8-3(6)10-4(7)9-2/h1H2,(H4,6,7,8,9,10)
