106261-64-7 Usage
Description
4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride is an organic compound that serves as a crucial intermediate in the synthesis of various pharmaceutical compounds. It is characterized by its chemical structure, which includes a benzoyl chloride group and a methylpiperazinyl moiety, contributing to its reactivity and potential applications in the pharmaceutical industry.
Uses
Used in Pharmaceutical Industry:
4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride is used as a key intermediate in the synthesis of Gleevec (G407000), a tyrosine kinase inhibitor. It is highly specific for BCR-ABL, an enzyme associated with chronic myelogenous leukemia (CML) and certain forms of acute lymphoblastic leukemia (ALL). The compound plays a vital role in the development of Gleevec and its related compounds, contributing to the treatment of these specific types of leukemia.
Additionally, 4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride is used in the synthesis of Gleevec N-4-((4-Methylpiperazin-1-yl)methyl)benzaldehyde (G407010), which is an impurity of Gleevec. The production and control of this impurity are essential for ensuring the safety and efficacy of the final pharmaceutical product.
Check Digit Verification of cas no
The CAS Registry Mumber 106261-64-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,6,2,6 and 1 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 106261-64:
(8*1)+(7*0)+(6*6)+(5*2)+(4*6)+(3*1)+(2*6)+(1*4)=97
97 % 10 = 7
So 106261-64-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H17ClN2O.2ClH/c1-15-6-8-16(9-7-15)10-11-2-4-12(5-3-11)13(14)17;;/h2-5H,6-10H2,1H3;2*1H
