106287-92-7 Usage
Chemical structure
A complex compound consisting of a cyclohexyl group, a methoxy group, a methyl group, and an indole-3-acetic acid group.
Derivative
A derivative of the natural hormone auxin, which plays a crucial role in plant growth and development.
Potential applications
Agricultural and horticultural practices, as it has the potential to influence plant growth and yield.
Unique structure
The presence of various functional groups, such as the cyclohexyl, methoxy, and methyl groups, contributes to its unique structure.
Research and development
An interesting target for further research and development in the field of plant biology and agrochemicals due to its unique structure and potential applications.
Functional groups
The presence of functional groups like the cyclohexyl, methoxy, and methyl groups allows for various interactions and reactions with other molecules, which can be exploited for different applications.
Molecular weight
Approximately 343.4 g/mol (calculated from the molecular formula)
Chemical classification
An indole-3-acetic acid derivative, which is a type of auxin, a plant hormone.
Biological activity
May have potential effects on plant growth and development, making it a candidate for further study in plant biology and agricultural applications.
Check Digit Verification of cas no
The CAS Registry Mumber 106287-92-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,6,2,8 and 7 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 106287-92:
(8*1)+(7*0)+(6*6)+(5*2)+(4*8)+(3*7)+(2*9)+(1*2)=127
127 % 10 = 7
So 106287-92-7 is a valid CAS Registry Number.
InChI:InChI=1/C20H25NO4/c1-13-16(11-20(23)24)17-10-15(25-2)8-9-18(17)21(13)12-19(22)14-6-4-3-5-7-14/h8-10,14H,3-7,11-12H2,1-2H3,(H,23,24)