106692-19-7 Usage
General Description
The chemical compound "(1-(4-dimethylaminoethoxy)phenyl)-1-(4-hydroxyphenyl)-2-bromo-2-phenylethylene" is a complex organic molecule that contains a combination of various functional groups including a bromine atom, a phenyl group, a hydroxyphenyl group, and a dimethylaminoethoxy group. It is an ethylene derivative with bulky substituents, making it a large and complex molecule. (1-(4-dimethylaminoethoxy)phenyl)-1-(4-hydroxyphenyl)-2-bromo-2-phenylethylene may have potential applications in pharmaceuticals, materials science, or other chemical industries due to its unique structure and functional groups, but further research and testing are likely necessary to fully understand its potential uses and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 106692-19-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,6,6,9 and 2 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 106692-19:
(8*1)+(7*0)+(6*6)+(5*6)+(4*9)+(3*2)+(2*1)+(1*9)=127
127 % 10 = 7
So 106692-19-7 is a valid CAS Registry Number.
InChI:InChI=1/C24H24BrNO2/c1-26(2)16-17-28-22-14-10-19(11-15-22)23(18-8-12-21(27)13-9-18)24(25)20-6-4-3-5-7-20/h3-15,27H,16-17H2,1-2H3/b24-23+