107535-01-3 Usage
Description
ANTHO-RFAMIDE, a FMRFamide-related neuropeptide, functions as an agonist for the orphan G-protein-coupled receptor GPR54. It plays a significant role in various physiological processes and holds potential therapeutic applications.
Uses
Used in Pharmaceutical Industry:
ANTHO-RFAMIDE is used as a therapeutic agent for targeting the orphan G-protein-coupled receptor GPR54. Its activation of this receptor can lead to potential treatments for various conditions, including certain cancers and other diseases where GPR54 plays a role in their pathology.
Used in Research Applications:
ANTHO-RFAMIDE serves as a valuable research tool for studying the function and role of the GPR54 receptor in cellular processes and disease mechanisms. It can be utilized in laboratory experiments to investigate the receptor's interactions with other cellular components and its potential as a therapeutic target.
Check Digit Verification of cas no
The CAS Registry Mumber 107535-01-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,7,5,3 and 5 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 107535-01:
(8*1)+(7*0)+(6*7)+(5*5)+(4*3)+(3*5)+(2*0)+(1*1)=103
103 % 10 = 3
So 107535-01-3 is a valid CAS Registry Number.
InChI:InChI=1/C22H32N8O5/c23-19(33)16(11-13-5-2-1-3-6-13)30-21(35)14(7-4-10-26-22(24)25)29-18(32)12-27-20(34)15-8-9-17(31)28-15/h1-3,5-6,14-16H,4,7-12H2,(H2,23,33)(H,27,34)(H,28,31)(H,29,32)(H,30,35)(H4,24,25,26)/t14-,15-,16-/m0/s1