1084-43-1 Usage
General Description
1,3-diamino-5-methylphenazinium chloride is a chemical compound with the molecular formula C13H15N4Cl. It is a derivative of phenazine and is commonly used as a redox indicator in chemistry experiments. 1,3-diamino-5-methylphenazinium chloride is frequently utilized in analytical and biochemical studies to detect the presence of certain substances in a solution. Additionally, 1,3-diamino-5-methylphenazinium chloride has been investigated for its potential use in photodynamic therapy for cancer treatment due to its ability to generate cytotoxic singlet oxygen when exposed to specific wavelengths of light. However, further research is needed to determine its safety and efficacy for this application. This chemical is typically handled and used in laboratory settings under strict safety protocols to prevent exposure and minimize potential risks.
Check Digit Verification of cas no
The CAS Registry Mumber 1084-43-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,8 and 4 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 1084-43:
(6*1)+(5*0)+(4*8)+(3*4)+(2*4)+(1*3)=61
61 % 10 = 1
So 1084-43-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H14N4/c1-17-11-5-3-2-4-10(11)16-13-9(15)6-8(14)7-12(13)17/h2-7,9H,14-15H2,1H3
