108446-76-0 Usage
General Description
3-(3-Biphenyl-4-yl-1-phenyl-1H-pyrazol-4-yl)-acrylic acid is a chemical compound with a complex structure containing a biphenyl group and a pyrazole group. It is classified as an acrylic acid derivative. 3-(3-BIPHENYL-4-YL-1-PHENYL-1H-PYRAZOL-4-YL)-ACRYLIC ACID has the potential to be used in various applications such as pharmaceuticals, agrochemicals, and materials science due to its unique structure and properties. Its specific uses could include as a building block for the synthesis of new drugs or as a ligand in catalytic reactions. Further research and testing are necessary to fully understand the potential applications and properties of 3-(3-Biphenyl-4-yl-1-phenyl-1H-pyrazol-4-yl)-acrylic acid.
Check Digit Verification of cas no
The CAS Registry Mumber 108446-76-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,8,4,4 and 6 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 108446-76:
(8*1)+(7*0)+(6*8)+(5*4)+(4*4)+(3*6)+(2*7)+(1*6)=130
130 % 10 = 0
So 108446-76-0 is a valid CAS Registry Number.
InChI:InChI=1/C24H18N2O2/c27-23(28)16-15-21-17-26(22-9-5-2-6-10-22)25-24(21)20-13-11-19(12-14-20)18-7-3-1-4-8-18/h1-17H,(H,27,28)/p-1/b16-15+
108446-76-0Relevant articles and documents
Microwave-Assisted Synthesis of 3-(4-Pyrazolyl)propenoic Acids
Chornous, Vitaliy O.,Bratenko, Mykhaylo K.,Vovk, Mykhaylo V.
, p. 79 - 83 (2007/10/03)
Under microwave activation, pyrazole-4-carboxaldehydes react with malonic acid in the presence of a small amount of pyridine to give 3-(4-pyrazolyl)propenoic acids in high yields.