109220-81-7 Usage
General Description
4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)-phenylamine is a chemical compound with a complex molecular structure. It is a derivative of triazoloazepine and contains a phenylamine group. 4-(6,7,8,9-TETRAHYDRO-5H-[1,2,4]TRIAZOLO[4,3-A]AZEPIN-3-YL)-PHENYLAMINE has potential applications in the field of medicinal chemistry, especially in the development of new pharmaceuticals. Its unique structure and properties make it an interesting target for further research and exploration. The synthesis and characterization of this compound could lead to the discovery of novel drug candidates with promising therapeutic effects. However, further studies are needed to fully understand its pharmacological properties and potential uses in various medical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 109220-81-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,9,2,2 and 0 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 109220-81:
(8*1)+(7*0)+(6*9)+(5*2)+(4*2)+(3*0)+(2*8)+(1*1)=97
97 % 10 = 7
So 109220-81-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H16N4/c14-11-7-5-10(6-8-11)13-16-15-12-4-2-1-3-9-17(12)13/h5-8H,1-4,9,14H2