109305-67-1 Usage
General Description
[(3-Bromo-1,2,4-thiadiazol-5-ylthio)methyl] methylcyanocarbonimidodithioate is a chemical compound that is derived from thiadiazole and cyanocarbonimidodithioate. It is a yellow crystalline solid with the molecular formula C5H4BrN5S3. [(3-BROMO-1,2,4-THIADIAZOL-5-YLTHIO)METHYL] METHYLCYANOCARBONIMIDODITHIOATE is commonly used in the field of organic chemistry and chemical research as a reactive intermediate in the synthesis of various organic compounds. It possesses potential biological activities and is being studied for its potential pharmacological applications. However, due to its complex structure and reactivity, it requires careful handling and should only be used by trained professionals in a controlled laboratory setting.
Check Digit Verification of cas no
The CAS Registry Mumber 109305-67-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,9,3,0 and 5 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 109305-67:
(8*1)+(7*0)+(6*9)+(5*3)+(4*0)+(3*5)+(2*6)+(1*7)=111
111 % 10 = 1
So 109305-67-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BrN4S4/c1-12-5(9-2-8)13-3-14-6-10-4(7)11-15-6/h3H2,1H3/b9-5+
