109647-95-2 Usage
Description
3-AMINO-3-CYCLOHEXYL-PROPAN-1-OL, also known as 3-Aminocyclohexanol, is an organic compound with the molecular formula C9H19NO. It features a cyclohexane ring with an amino group and a propyl group attached to it. This versatile compound is known for its potential applications in various industries due to its unique structural properties.
Uses
Used in Pharmaceutical Industry:
3-AMINO-3-CYCLOHEXYL-PROPAN-1-OL is used as a synthetic intermediate for the development of novel cyclic isothioureas. These compounds act as NPY Y1 receptor antagonists, which have potential applications in the treatment of various medical conditions, such as obesity, anxiety, and depression. The compound's unique structure allows for the creation of new drugs that can modulate the activity of the NPY Y1 receptor, offering new therapeutic options for patients.
Check Digit Verification of cas no
The CAS Registry Mumber 109647-95-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,9,6,4 and 7 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 109647-95:
(8*1)+(7*0)+(6*9)+(5*6)+(4*4)+(3*7)+(2*9)+(1*5)=152
152 % 10 = 2
So 109647-95-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H19NO/c10-9(6-7-11)8-4-2-1-3-5-8/h8-9,11H,1-7,10H2
