109705-14-8 Usage
Description
1-FLUORO-2,4,6-TRIMETHYLPYRIDINIUM TETRAFLUOROBORATE is a chemical compound that serves as a versatile reagent in various organic synthesis processes. It is characterized by its unique structure, which includes a fluorine atom and a tetrafluoroborate anion, making it a valuable component in the synthesis of complex organic molecules.
Uses
Used in Organic Synthesis:
1-FLUORO-2,4,6-TRIMETHYLPYRIDINIUM TETRAFLUOROBORATE is used as a reactant for Pd(II)-catalyzed para-selective C-H arylation, enabling the selective formation of desired products in the synthesis of complex organic molecules. This selective arylation is crucial for the development of pharmaceuticals and other specialty chemicals.
Used in Fluorination Reactions:
1-FLUORO-2,4,6-TRIMETHYLPYRIDINIUM TETRAFLUOROBORATE is also used as a reagent in fluorination reactions, where it can introduce a fluorine atom into organic molecules. Fluorination is an important process in the synthesis of various pharmaceuticals, agrochemicals, and materials, as the introduction of fluorine can significantly alter the properties and reactivity of the molecule.
Used in Aryl Trifluoromethylation Reactions:
1-FLUORO-2,4,6-TRIMETHYLPYRIDINIUM TETRAFLUOROBORATE is utilized in aryl trifluoromethylation reactions, which involve the introduction of a trifluoromethyl group (CF3) into aromatic compounds. This modification can enhance the stability, lipophilicity, and biological activity of the resulting molecules, making it an essential process in the development of new drugs and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 109705-14-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,9,7,0 and 5 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 109705-14:
(8*1)+(7*0)+(6*9)+(5*7)+(4*0)+(3*5)+(2*1)+(1*4)=118
118 % 10 = 8
So 109705-14-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H11FN.BF4/c1-6-4-7(2)10(9)8(3)5-6;2-1(3,4)5/h4-5H,1-3H3;/q+1;-1