110816-79-0 Usage
Description
Ethyl 5-[2-[(2S)-2,6-diaminohexanoyl]oxy-3-(2-ethoxycarbonyl-4-oxo-chromen-5-yl)oxy-propoxy]-4-oxo-chromene-2-carboxylate is a complex organic compound with a unique molecular structure. It is characterized by its ethyl ester group, a 5-membered chromene ring, and various functional groups such as amino, oxy, and carbonyl groups. ethyl 5-[2-[(2S)-2,6-diaminohexanoyl]oxy-3-(2-ethoxycarbonyl-4-oxo-chromen-5-yl)oxy-propoxy]-4-oxo-chromene-2-carboxylate has potential applications in various fields due to its chemical properties and reactivity.
Uses
Used in Pharmaceutical Industry:
Ethyl 5-[2-[(2S)-2,6-diaminohexanoyl]oxy-3-(2-ethoxycarbonyl-4-oxo-chromen-5-yl)oxy-propoxy]-4-oxo-chromene-2-carboxylate is used as a pharmaceutical intermediate for the synthesis of various drugs. Its unique structure and functional groups make it a promising candidate for the development of new therapeutic agents.
Used in Chemical Research:
ethyl 5-[2-[(2S)-2,6-diaminohexanoyl]oxy-3-(2-ethoxycarbonyl-4-oxo-chromen-5-yl)oxy-propoxy]-4-oxo-chromene-2-carboxylate is also used in chemical research as a model compound to study the reactivity and properties of complex organic molecules. It can provide insights into the synthesis and modification of similar compounds for various applications.
Used in Identification of Non-Nucleoside Human Ribonucleotide Reductase Modulators:
Ethyl 5-[2-[(2S)-2,6-diaminohexanoyl]oxy-3-(2-ethoxycarbonyl-4-oxo-chromen-5-yl)oxy-propoxy]-4-oxo-chromene-2-carboxylate is used in the identification of non-nucleoside human ribonucleotide reductase modulators and their antitumor activity. Its unique structure allows it to interact with specific enzymes and proteins, making it a valuable tool in the discovery of new cancer therapies.
Used in Drug Delivery Systems:
ethyl 5-[2-[(2S)-2,6-diaminohexanoyl]oxy-3-(2-ethoxycarbonyl-4-oxo-chromen-5-yl)oxy-propoxy]-4-oxo-chromene-2-carboxylate can also be used in the development of drug delivery systems, where its chemical properties can be exploited to improve the solubility, stability, and bioavailability of therapeutic agents. Its functional groups can be modified to enhance the targeting and release of drugs in the body.
Check Digit Verification of cas no
The CAS Registry Mumber 110816-79-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,0,8,1 and 6 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 110816-79:
(8*1)+(7*1)+(6*0)+(5*8)+(4*1)+(3*6)+(2*7)+(1*9)=100
100 % 10 = 0
So 110816-79-0 is a valid CAS Registry Number.
InChI:InChI=1/C33H36N2O12/c1-3-41-32(39)27-15-21(36)29-23(10-7-12-25(29)46-27)43-17-19(45-31(38)20(35)9-5-6-14-34)18-44-24-11-8-13-26-30(24)22(37)16-28(47-26)33(40)42-4-2/h7-8,10-13,15-16,19-20H,3-6,9,14,17-18,34-35H2,1-2H3/t20-/m0/s1