110999-36-5 Usage
General Description
3-(Aminocarbonyl)-1,4-dimethylpyridinium chloride is a chemical compound with the molecular formula C9H14ClN2O. It is commonly used in organic synthesis as a reagent for the preparation of various heterocyclic compounds. It is a quaternary ammonium salt with a pyridinium core and an aminocarbonyl functional group. 3-(AMINOCARBONYL)-1,4-DIMETHYLPYRIDINIUM CHLORIDE is often utilized as a catalyst or as a key intermediate in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Additionally, it has potential applications in the field of medicinal chemistry and drug development due to its versatile properties and unique molecular structure. Overall, 3-(aminocarbonyl)-1,4-dimethylpyridinium chloride is an important and versatile chemical with various industrial and scientific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 110999-36-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,0,9,9 and 9 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 110999-36:
(8*1)+(7*1)+(6*0)+(5*9)+(4*9)+(3*9)+(2*3)+(1*6)=135
135 % 10 = 5
So 110999-36-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O/c1-6-3-4-10(2)5-7(6)8(9)11/h3-5H,1-2H3,(H-,9,11)/p+1