111139-55-0 Usage
Description
2,4,5-TRIMETHOXYBENZOIC ACID is an organic compound characterized by its molecular structure featuring a benzoic acid backbone with three methoxy groups attached at the 2nd, 4th, and 5th positions. It is known for its potential applications in various industries due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
2,4,5-TRIMETHOXYBENZOIC ACID is used as an intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with specific therapeutic properties.
Used in Chemical Synthesis:
2,4,5-TRIMETHOXYBENZOIC ACID is used as a building block in the synthesis of complex organic molecules, particularly in the field of organic chemistry. Its versatile structure makes it a valuable component in creating a wide range of chemical products.
Used in Research and Development:
2,4,5-TRIMETHOXYBENZOIC ACID is utilized in research and development for studying its chemical properties and potential applications in various fields. It serves as a model compound for understanding the behavior of similar structures and their interactions with other molecules.
Used in Material Science:
2,4,5-TRIMETHOXYBENZOIC ACID may be used in the development of new materials with specific properties, such as improved stability or reactivity. Its unique structure can contribute to the creation of advanced materials for various applications.
Note: The provided materials do not contain specific uses for 2,4,5-TRIMETHOXYBENZOIC ACID, so the uses listed above are inferred based on the general properties and potential applications of similar organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 111139-55-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,1,1,3 and 9 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 111139-55:
(8*1)+(7*1)+(6*1)+(5*1)+(4*3)+(3*9)+(2*5)+(1*5)=80
80 % 10 = 0
So 111139-55-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H11NO2S/c12-9(11(13)14)6-8-5-7-3-1-2-4-10(7)15-8/h1-5,9H,6,12H2,(H,13,14)/t9-/m1/s1
111139-55-0Relevant articles and documents
(R)-1,2,3,4-Tetrahydrobenzothienopyridines: Novel Optically Active Compounds with Strong 5-HT1A Receptor Binding Ability Exhibiting Anticonflict Activity and Lessening of Memory Impairment
Kawakubo, Hiromu,Takagi, Seiji,Yamaura, Yuuji,Katoh, Shinichi,Ishimoto, Yumiko,et al.
, p. 3526 - 3532 (1993)
(R)-1,2,3,4-Tetrahydrobenzothienopyridine derivatives (60-114) were synthesized.The (R)-isomers have affinity for the 5-HT1A receptor while the (S)-isomers have no such ability.The affinity of the (R)-isomers was discussed on the basis of structure-activity relationships between the affinity and hydrophobicity of the (R)-isomers.Compounds 71 and 107, which are representative derivative compounds, have anticonflict activity and lessening of memory impairment.In particular, compound 107 cannot bind to receptors other than the 5-HT1A receptor, demonstrating that it is a unique compound with a different mechanism of action from that of conventional anxiolytics.