111790-32-0 Usage
Description
1-((5-Bromo-2-benzofuranyl)phenylmethyl)-1H-imidazole is a chemical compound with the molecular formula C19H14BrN3O. It is an imidazole derivative featuring a benzofuran ring and a bromine substituent. 1-((5-Bromo-2-benzofuranyl)phenylmethyl)-1H-imidazole has demonstrated potential biological activity and is being investigated for its possible applications as a pharmaceutical agent. Its unique structural features and potential pharmacological properties make it a promising candidate for use in medicinal chemistry and drug development. However, further research and studies are necessary to fully comprehend its properties and potential uses.
Uses
Used in Pharmaceutical Industry:
1-((5-Bromo-2-benzofuranyl)phenylmethyl)-1H-imidazole is used as a pharmaceutical agent for its potential biological activity. 1-((5-Bromo-2-benzofuranyl)phenylmethyl)-1H-imidazole's structural features and pharmacological properties make it a candidate for development in the pharmaceutical industry, where it could be utilized in the creation of new drugs or therapies.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 1-((5-Bromo-2-benzofuranyl)phenylmethyl)-1H-imidazole is used as a compound with potential applications in drug development. Its unique structure and properties may contribute to the design and synthesis of novel therapeutic agents, targeting various diseases and conditions.
Used in Drug Development:
1-((5-Bromo-2-benzofuranyl)phenylmethyl)-1H-imidazole is used as a compound in drug development due to its potential pharmacological properties. Further research into its biological activity and interactions with biological targets could lead to the discovery of new drugs or treatments for a range of medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 111790-32-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,1,7,9 and 0 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 111790-32:
(8*1)+(7*1)+(6*1)+(5*7)+(4*9)+(3*0)+(2*3)+(1*2)=100
100 % 10 = 0
So 111790-32-0 is a valid CAS Registry Number.
InChI:InChI=1/C18H13BrN2O.ClH/c19-15-6-7-16-14(10-15)11-17(22-16)18(21-9-8-20-12-21)13-4-2-1-3-5-13;/h1-12,18H;1H
