115336-09-9 Usage
General Description
Guanidinophenylalanine-2-naphthylamide is a chemical compound used in biochemical research and assays to detect the activity of enzymes such as trypsin and elastase. It consists of a guanidino group attached to a phenylalanine amino acid, which is further linked to a naphthylamide moiety. Guanidinophenylalanine-2-naphthylamide is commonly used as a substrate in enzyme assays due to its ability to be cleaved by specific enzymes, resulting in a colorimetric or fluorescent change that can be easily measured. Guanidinophenylalanine-2-naphthylamide is a valuable tool in studying enzyme kinetics, specificity, and inhibition, making it a crucial component in the field of biochemistry and molecular biology.
Check Digit Verification of cas no
The CAS Registry Mumber 115336-09-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,5,3,3 and 6 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 115336-09:
(8*1)+(7*1)+(6*5)+(5*3)+(4*3)+(3*6)+(2*0)+(1*9)=99
99 % 10 = 9
So 115336-09-9 is a valid CAS Registry Number.
InChI:InChI=1/C20H21N5O/c21-18(11-13-5-8-16(9-6-13)25-20(22)23)19(26)24-17-10-7-14-3-1-2-4-15(14)12-17/h1-10,12,18H,11,21H2,(H,24,26)(H4,22,23,25)