115392-27-3 Usage
General Description
RED 500 is a chemical compound commonly used as a red pigment in various applications such as inks, coatings, and plastics. It is a synthetic organic compound that belongs to the azo dye family, with the chemical name 1-(2,3-dihydro-6-methyl-1,3-dioxo-1H-inden-6-yl)-2-hydroxy-4-(2-methyl-2-propanylazo)-1-naphthal-sulfonic acid. RED 500 exhibits strong color intensity and good lightfastness, making it suitable for use in outdoor and high-exposure applications. Additionally, it is known for its high stability and compatibility with a wide range of materials, allowing for versatile use in various industries. Despite its usefulness, RED 500 is also known to pose potential health and environmental risks if not handled and disposed of properly.
Check Digit Verification of cas no
The CAS Registry Mumber 115392-27-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,5,3,9 and 2 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 115392-27:
(8*1)+(7*1)+(6*5)+(5*3)+(4*9)+(3*2)+(2*2)+(1*7)=113
113 % 10 = 3
So 115392-27-3 is a valid CAS Registry Number.
InChI:InChI=1/C31H29NO3/c1-4-32(18-17-20(2)3)22-14-15-26-28(19-22)34-27-16-13-21-9-5-6-10-23(21)29(27)31(26)25-12-8-7-11-24(25)30(33)35-31/h5-16,19-20H,4,17-18H2,1-3H3