1159-89-3 Usage
Molecular structure
The compound has a complex molecular structure, consisting of a quinazolin-4(1H)-one core, a pyridinyl group, and a dimethylaminoethyl side chain.
Core structure
The quinazolin-4(1H)-one core is a fused ring system that serves as the central framework of the molecule.
Pyridinyl group
A pyridinyl group is attached to the quinazolin-4(1H)-one core, which is a heterocyclic aromatic ring containing nitrogen.
Dimethylaminoethyl side chain
The molecule also features a dimethylaminoethyl side chain, which is an alkyl chain with a dimethylamino group attached.
Potential pharmaceutical applications
Due to its structural features, the compound may have potential pharmaceutical applications and could be used in the development of new drugs.
Further research needed
More research and analysis are required to fully understand the properties and potential uses of 1-[2-(Dimethylamino)ethyl]-2,3-dihydro-2-(2-pyridinyl)quinazolin-4(1H)-one.
Molecular weight
The molecular weight of the compound is approximately 312.38 g/mol.
Solubility
The solubility of the compound in various solvents is not provided in the material, but it may vary depending on the specific solvent and conditions.
Stability
Information about the stability of the compound under different conditions is not provided in the material, but it may be influenced by factors such as temperature, pH, and exposure to light or air.
Check Digit Verification of cas no
The CAS Registry Mumber 1159-89-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,5 and 9 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1159-89:
(6*1)+(5*1)+(4*5)+(3*9)+(2*8)+(1*9)=83
83 % 10 = 3
So 1159-89-3 is a valid CAS Registry Number.
InChI:InChI=1/C17H20N4O/c1-20(2)11-12-21-15-9-4-3-7-13(15)17(22)19-16(21)14-8-5-6-10-18-14/h3-10,16H,11-12H2,1-2H3,(H,19,22)