119305-41-8 Usage
Xanthine core structure
The compound has a xanthine core, which is a common structure found in many biologically active molecules.
Isothiocyanate group
The presence of an isothiocyanate group suggests potential reactivity and the ability to form covalent bonds with biological targets.
Amino groups
The presence of multiple amino groups indicates potential for hydrogen bonding and interactions with biological targets.
Methyloxy group
The methyloxy group adds a hydroxyl group to the compound, which can increase solubility and potentially enhance interactions with biological targets.
Central nervous system stimulant potential
As a xanthine derivative, the compound may have the ability to stimulate the central nervous system.
Bronchodilator potential
The compound may also have the potential to act as a bronchodilator, helping to relax and widen the airways.
Medicinal chemistry and drug development interest
Due to its complex structure and potential pharmacological properties, the compound is of interest in the fields of medicinal chemistry and drug development.
Further investigation and testing required
The specific biological activities and potential applications of the compound would need to be explored through additional research and testing.
Check Digit Verification of cas no
The CAS Registry Mumber 119305-41-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,9,3,0 and 5 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 119305-41:
(8*1)+(7*1)+(6*9)+(5*3)+(4*0)+(3*5)+(2*4)+(1*1)=108
108 % 10 = 8
So 119305-41-8 is a valid CAS Registry Number.
InChI:InChI=1/C29H32N8O5S2/c1-3-14-36-26-24(27(39)37(15-4-2)29(36)41)33-25(34-26)19-8-10-22(11-9-19)42-17-23(38)30-12-13-31-28(40)44-35-21-7-5-6-20(16-21)32-18-43/h5-11,16,35H,3-4,12-15,17H2,1-2H3,(H,30,38)(H,31,40)(H,33,34)