1198-60-3 Usage
Description
1,3,5-Trichlorobenzene-d3 (CAS# 1198-60-3) is an isotopically labeled research compound that is widely utilized in various scientific and industrial applications due to its unique properties. It is a derivative of trichlorobenzene with three deuterium atoms, which makes it an ideal candidate for research purposes.
Uses
Used in Research and Development:
1,3,5-Trichlorobenzene-d3 is used as a research compound for the study of chemical reactions and processes. The presence of deuterium atoms in the molecule allows for the investigation of reaction mechanisms, kinetics, and isotope effects, which are crucial for understanding the underlying principles of various chemical phenomena.
Used in Analytical Chemistry:
In the field of analytical chemistry, 1,3,5-Trichlorobenzene-d3 serves as an internal standard or a reference compound for the quantification and identification of target analytes. Its isotopically labeled nature provides a reliable and accurate means of comparing the properties of other compounds, ensuring precise measurements and results.
Used in Environmental Studies:
1,3,5-Trichlorobenzene-d3 is employed as a tracer compound in environmental studies, particularly in the assessment of the fate and transport of pollutants in the environment. Its unique isotopic signature allows researchers to track and monitor the behavior of contaminants, providing valuable insights into their distribution, persistence, and potential impacts on ecosystems.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1,3,5-Trichlorobenzene-d3 is utilized as a starting material or an intermediate in the synthesis of various drugs and drug candidates. Its isotopically labeled nature can be advantageous in the development of new drugs, as it can help in the identification of active compounds and the optimization of their pharmacological properties.
Used in Material Science:
1,3,5-Trichlorobenzene-d3 is also used in material science for the development of novel materials with specific properties. Its unique isotopic composition can be exploited to create materials with enhanced performance characteristics, such as improved stability, reactivity, or selectivity, which can be applied in various industrial processes and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1198-60-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,9 and 8 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 1198-60:
(6*1)+(5*1)+(4*9)+(3*8)+(2*6)+(1*0)=83
83 % 10 = 3
So 1198-60-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H3Cl3/c7-4-1-5(8)3-6(9)2-4/h1-3H/i1D,2D,3D
