120153-08-4 Usage
Description
3-Carboxy-4-fluorophenylboronic acid is an organic compound that features a boronic acid group attached to a substituted phenyl ring. This molecule is characterized by the presence of a carboxylic acid group at the 3-position and a fluorine atom at the 4-position on the phenyl ring. It is known for its unique chemical properties and reactivity, making it a valuable building block in organic synthesis and medicinal chemistry.
Uses
Used in Suzuki Reaction:
3-Carboxy-4-fluorophenylboronic acid is used as a reagent in the Suzuki reaction, a widely employed cross-coupling reaction in organic chemistry. This reaction facilitates the formation of carbon-carbon bonds between an aryl or vinyl boronic acid and an aryl or vinyl halide or triflate in the presence of a palladium catalyst and a base. The use of 3-Carboxy-4-fluorophenylboronic acid in this reaction allows for the efficient synthesis of biaryl and vinylarene compounds, which are important structural motifs in pharmaceuticals, agrochemicals, and materials science.
Used in Medicinal Chemistry:
3-Carboxy-4-fluorophenylboronic acid is used as a key intermediate in the discovery and synthesis of novel azaindole-based series as potent AXL kinase inhibitors. AXL kinase is a receptor tyrosine kinase involved in various cellular processes, including cell survival, migration, and invasion. Inhibition of AXL kinase has been implicated in the treatment of various diseases, such as cancer and fibrosis. The carboxylic acid and fluorophenyl groups in 3-Carboxy-4-fluorophenylboronic acid provide opportunities for further functionalization and optimization of the azaindole-based inhibitors, enhancing their potency, selectivity, and pharmacokinetic properties.
Check Digit Verification of cas no
The CAS Registry Mumber 120153-08-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,0,1,5 and 3 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 120153-08:
(8*1)+(7*2)+(6*0)+(5*1)+(4*5)+(3*3)+(2*0)+(1*8)=64
64 % 10 = 4
So 120153-08-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H6BFO4/c9-6-3-4(8(12)13)1-2-5(6)7(10)11/h1-3,12-13H,(H,10,11)
