122584-17-2 Usage
Description
INETERMEDIATE OF GALANTHAMINE 2, also known as N-(p-Hydroxyphenethyl)-N-(3-hydroxy-4-methoxybenzyl)formamide (CAS# 122584-17-2), is an off-white solid compound that plays a crucial role in organic synthesis. It is particularly valuable for its applications in various industries due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
INETERMEDIATE OF GALANTHAMINE 2 is used as an intermediate compound for the synthesis of various pharmaceutical products. Its unique chemical structure allows it to be a key component in the development of new drugs and therapies.
Used in Organic Synthesis:
In the field of organic synthesis, INETERMEDIATE OF GALANTHAMINE 2 is used as a building block for creating more complex organic molecules. Its versatility in chemical reactions makes it a valuable asset for researchers and chemists working on developing new compounds with specific properties and applications.
Used in Chemical Research:
INETERMEDIATE OF GALANTHAMINE 2 is also utilized in chemical research as a model compound to study various reaction mechanisms and to understand the behavior of similar molecules. This helps in advancing the knowledge of organic chemistry and contributes to the development of new synthetic methods and techniques.
Check Digit Verification of cas no
The CAS Registry Mumber 122584-17-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,2,5,8 and 4 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 122584-17:
(8*1)+(7*2)+(6*2)+(5*5)+(4*8)+(3*4)+(2*1)+(1*7)=112
112 % 10 = 2
So 122584-17-2 is a valid CAS Registry Number.
InChI:InChI=1/C17H19NO4/c1-22-17-7-4-14(10-16(17)21)11-18(12-19)9-8-13-2-5-15(20)6-3-13/h2-7,10,12,20-21H,8-9,11H2,1H3
122584-17-2Relevant articles and documents
Enzymatic oxidative cyclisation reactions leading to dibenzoazocanes
Tozzi, Francesco,Ley, Steven V.,Kitching, Matthew O.,Baxendale, Ian R.
supporting information; experimental part, p. 1919 - 1922 (2010/10/02)
From simple N-isovanillyltyramine derivatives double oxidative biotransformations can be achieved using tyrosinase leading to the corresponding hydroxylated dibenzoazocanes. Georg Thieme Verlag Stuttgart.
Processes for the preparation of derivatives of 4a,5,9,10,11,12-hexahydro-6H-benzofuro-[3a,3,2-ef][2]benzazepine
-
, (2008/06/13)
The invention relates to processes for the preparation of 4a,5,9,10,11,12-hexahydro-6H-benzofuro(3a,3,2-ef)(2)benzazepine, or derivatives thereof. Furthermore, the invention also relates to the compounds formed during the preparation of 4a,5,9,10,11,12-hexahydro-6H-benzofuro(3a,3,2-ef)(2)benzazepine.
