1228183-22-9 Usage
General Description
1H-Benzo[d]imidazol-6-ylboronic acid is a chemical compound that belongs to the class of boronic acids. It is composed of a boronic acid group attached to a benzimidazole ring, which contains nitrogen and carbon atoms. 1H-Benzo[d]imidazol-6-ylboronic acid has the potential for forming covalent bonds with other molecules, making it useful in various chemical reactions and as a building block for the synthesis of more complex organic compounds. Boronic acids, in general, are known for their ability to form stable complexes with diols and other electron-rich compounds, and they have found applications in pharmaceuticals, materials science, and organic chemistry research.
Check Digit Verification of cas no
The CAS Registry Mumber 1228183-22-9 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,2,2,8,1,8 and 3 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1228183-22:
(9*1)+(8*2)+(7*2)+(6*8)+(5*1)+(4*8)+(3*3)+(2*2)+(1*2)=139
139 % 10 = 9
So 1228183-22-9 is a valid CAS Registry Number.
InChI:InChI=1S/C7H7BN2O2/c11-8(12)5-1-2-6-7(3-5)10-4-9-6/h1-4,11-12H,(H,9,10)