125-85-9 Usage
Description
Caramiphen hydrochloride, a derivative of phenol, is a pharmaceutical compound with various applications in the medical field. It is known for its ability to inhibit certain ion channels, particularly voltage-gated sodium channels, which play a crucial role in nerve and muscle function.
Uses
Used in Pharmaceutical Research:
Caramiphen hydrochloride is used as a research compound for studying the effects of voltage-gated Na+ channels. Its application in this field is significant because it helps researchers understand the role of these channels in various physiological processes and how they can be targeted for therapeutic purposes.
Used in Patch-Clamp Method:
Caramiphen hydrochloride is used as an inhibitory agent in the patch-clamp method, a widely employed electrophysiological technique for studying ion channels in cell membranes. By using caramiphen hydrochloride, researchers can investigate the inhibitory effects on voltage-gated Na+ currents, which can provide valuable insights into the development of drugs targeting these channels for various medical conditions.
Biochem/physiol Actions
Caramiphen hydrochloride is non-narcotic and possesses many biological functionalities of being antitussive, anticonvulsive, and neuroprotective. It induces sensory block and displays less toxicity when compared to bupivacaine. The local anesthetic functionality of caramiphen is mediated by its inhibitory effect on voltage-gated Na+ currents.
Check Digit Verification of cas no
The CAS Registry Mumber 125-85-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,2 and 5 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 125-85:
(5*1)+(4*2)+(3*5)+(2*8)+(1*5)=49
49 % 10 = 9
So 125-85-9 is a valid CAS Registry Number.
InChI:InChI=1/C18H27NO2.ClH/c1-3-19(4-2)14-15-21-17(20)18(12-8-9-13-18)16-10-6-5-7-11-16;/h5-7,10-11H,3-4,8-9,12-15H2,1-2H3;1H
