125127-62-0 Usage
Molecular structure
The compound has a complex molecular structure with a benzoin skeleton, benzo[c,d]indolium derivative, and various substituents such as ethyl, cyclopentene, and phenyl groups attached to the benzene ring.
Double bonds
The compound has a complex arrangement of double bonds, denoted by "(E)" configuration, which indicates the presence of cis-trans isomerism and may influence its reactivity and physical properties.
Potential applications
Due to its intricate structure and potential reactivity, the compound may have applications in fields such as pharmaceuticals, dyes, and materials science. These applications could involve its use as an active pharmaceutical ingredient, a precursor to other complex molecules, or as a functional material with unique properties.
Stability
The presence of the tetrafluoroborate anion and the complex arrangement of double bonds and substituents may contribute to the compound's stability, making it suitable for various applications and chemical transformations.
Isomerism
The compound exhibits cis-trans isomerism due to the presence of double bonds with the "(E)" configuration, which may result in different physical and chemical properties depending on the spatial arrangement of the substituents.
Synthesis
The synthesis of this complex compound likely involves multiple steps and the use of various reagents to introduce the different substituents and achieve the desired molecular structure.
Check Digit Verification of cas no
The CAS Registry Mumber 125127-62-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,5,1,2 and 7 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 125127-62:
(8*1)+(7*2)+(6*5)+(5*1)+(4*2)+(3*7)+(2*6)+(1*2)=100
100 % 10 = 0
So 125127-62-0 is a valid CAS Registry Number.
InChI:InChI=1/C41H35N2.BF4/c1-3-42-35(33-18-8-14-29-16-10-20-37(42)40(29)33)26-24-31-22-23-32(39(31)28-12-6-5-7-13-28)25-27-36-34-19-9-15-30-17-11-21-38(41(30)34)43(36)4-2;2-1(3,4)5/h5-21,24-27H,3-4,22-23H2,1-2H3;/q+1;-1