125483-28-5 Usage
General Description
"Methyl 3-(methoxycarbonyl)-7-oxo-9-azabicyclo[3.3.1]nonane-9-acetate" is a chemical compound that falls under the category of organic compounds, which means it's made of carbon atoms. The name signifies its structure; an azabicyclo compound that contains a nitrogen atom and two carbonyl groups. Its additional methyl and acetate groups may influence certain properties, like reactivity or solubility. However, detailed chemical and physical properties, possible uses, and safety precautions aren't registered or outlined in most scientific literature. This indicates that it may not be widely used, or it might be a part of more complex mixtures in chemical or pharmaceutical research and production.
Check Digit Verification of cas no
The CAS Registry Mumber 125483-28-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,5,4,8 and 3 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 125483-28:
(8*1)+(7*2)+(6*5)+(5*4)+(4*8)+(3*3)+(2*2)+(1*8)=125
125 % 10 = 5
So 125483-28-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H19NO5/c1-18-12(16)7-14-9-3-8(13(17)19-2)4-10(14)6-11(15)5-9/h8-10H,3-7H2,1-2H3
