126325-54-0 Usage
General Description
4-Amino-3,5-Dibromo-2-Methylpyridine is a chemical compound with the molecular formula C6H6Br2N2. This indicates it consists of six carbon atoms, six hydrogen atoms, two bromine atoms, and two nitrogen atoms. It belongs to the group of organic compounds known as pyridines and derivatives. Pyridines are compounds containing a pyridine ring, which is a six-membered aromatic ring with one nitrogen atom and five carbon atoms. This particular compound is further modified with amino, bromo, and methyl groups, making it an important building block in the synthesis of complex organic molecules. Its properties, like solubility and reactivity, depend on its exact structural form and the environment it is in. It is commonly used in the field of organic chemistry for various purposes such as in chemical synthesis, pharmaceuticals, and research.
Check Digit Verification of cas no
The CAS Registry Mumber 126325-54-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,6,3,2 and 5 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 126325-54:
(8*1)+(7*2)+(6*6)+(5*3)+(4*2)+(3*5)+(2*5)+(1*4)=110
110 % 10 = 0
So 126325-54-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H6Br2N2/c1-3-5(8)6(9)4(7)2-10-3/h2H,1H3,(H2,9,10)
